C28H17Cl2IN2O5 — CID 6182484
[3-(4-chlorobenzoyl)oxy-4-[(Z)-[(2-iodobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 6182484) has the molecular formula C28H17Cl2IN2O5 and a molecular weight of 659.26 g/mol. Its IUPAC name is [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(2-iodobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(2-iodobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6182484 |
| Molecular Formula | C28H17Cl2IN2O5 |
| Molecular Weight | 659.26 g/mol |
| Exact Mass | 657.96 |
| IUPAC Name | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(2-iodobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N\NC(=O)c2ccccc2I)c(OC(=O)c2ccc(Cl)cc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H17Cl2IN2O5/c29-20-10-5-17(6-11-20)27(35)37-22-14-9-19(16-32-33-26(34)23-3-1-2-4-24(23)31)25(15-22)38-28(36)18-7-12-21(30)13-8-18/h1-16H,(H,33,34)/b32-16- |
| InChIKey | QCLANNKNNIHDHB-ZMGVVAQMSA-N |
| XLogP | 6.80 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.26 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|