C20H19ClN2O5 — CID 5435092
[4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-3-propanoyloxyphenyl] propanoate (PubChem CID 5435092) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is [4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-3-propanoyloxyphenyl] propanoate.
| Compound Name | [4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-3-propanoyloxyphenyl] propanoate |
|---|---|
| PubChem CID | 5435092 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-3-propanoyloxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(/C=N\NC(=O)c2ccc(Cl)cc2)c(OC(=O)CC)c1 |
| InChI | InChI=1S/C20H19ClN2O5/c1-3-18(24)27-16-10-7-14(17(11-16)28-19(25)4-2)12-22-23-20(26)13-5-8-15(21)9-6-13/h5-12H,3-4H2,1-2H3,(H,23,26)/b22-12- |
| InChIKey | HLGOWZQBKIXQTH-UUYOSTAYSA-N |
| XLogP | 3.73 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|