C22H26Cl2N2O2 — CID 3312356
4-chloro-N-[(5-chloro-2-octoxyphenyl)methylideneamino]benzamide (PubChem CID 3312356) has the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 4-chloro-N-[(5-chloro-2-octoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(5-chloro-2-octoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3312356 |
| Molecular Formula | C22H26Cl2N2O2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-chloro-N-[(5-chloro-2-octoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCCCCCCOc1ccc(Cl)cc1C=NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26Cl2N2O2/c1-2-3-4-5-6-7-14-28-21-13-12-20(24)15-18(21)16-25-26-22(27)17-8-10-19(23)11-9-17/h8-13,15-16H,2-7,14H2,1H3,(H,26,27) |
| InChIKey | VKQMCTKAXJALFG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|