C20H22BrClN2O2 — CID 3367560
N-[(5-bromo-2-hexoxyphenyl)methylideneamino]-4-chlorobenzamide (PubChem CID 3367560) has the molecular formula C20H22BrClN2O2 and a molecular weight of 437.77 g/mol. Its IUPAC name is N-[(5-bromo-2-hexoxyphenyl)methylideneamino]-4-chlorobenzamide.
| Compound Name | N-[(5-bromo-2-hexoxyphenyl)methylideneamino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 3367560 |
| Molecular Formula | C20H22BrClN2O2 |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | N-[(5-bromo-2-hexoxyphenyl)methylideneamino]-4-chlorobenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C=NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22BrClN2O2/c1-2-3-4-5-12-26-19-11-8-17(21)13-16(19)14-23-24-20(25)15-6-9-18(22)10-7-15/h6-11,13-14H,2-5,12H2,1H3,(H,24,25) |
| InChIKey | QISCSWFIZFEJMK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|