C19H18BrClN2O3 — CID 4137892
[4-bromo-2-[[(4-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 4137892) has the molecular formula C19H18BrClN2O3 and a molecular weight of 437.72 g/mol. Its IUPAC name is [4-bromo-2-[[(4-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-bromo-2-[[(4-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 4137892 |
| Molecular Formula | C19H18BrClN2O3 |
| Molecular Weight | 437.72 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | [4-bromo-2-[[(4-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(Br)cc1C=NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18BrClN2O3/c1-19(2,3)18(25)26-16-9-6-14(20)10-13(16)11-22-23-17(24)12-4-7-15(21)8-5-12/h4-11H,1-3H3,(H,23,24) |
| InChIKey | LWCBFLRUNKYSEM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.72 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|