C21H22BrN3O4 — CID 4247095
[4-bromo-2-[[[4-(2,2-dimethylpropanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] acetate (PubChem CID 4247095) has the molecular formula C21H22BrN3O4 and a molecular weight of 460.33 g/mol. Its IUPAC name is [4-bromo-2-[[[4-(2,2-dimethylpropanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [4-bromo-2-[[[4-(2,2-dimethylpropanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 4247095 |
| Molecular Formula | C21H22BrN3O4 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | [4-bromo-2-[[[4-(2,2-dimethylpropanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Br)cc1C=NNC(=O)c1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H22BrN3O4/c1-13(26)29-18-10-7-16(22)11-15(18)12-23-25-19(27)14-5-8-17(9-6-14)24-20(28)21(2,3)4/h5-12H,1-4H3,(H,24,28)(H,25,27) |
| InChIKey | BXTAYJCVMZDUMS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|