C42H34Br2N6O8 — CID 4247539
bis[4-bromo-2-[[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] benzene-1,2-dicarboxylate (PubChem CID 4247539) has the molecular formula C42H34Br2N6O8 and a molecular weight of 910.58 g/mol. Its IUPAC name is bis[4-bromo-2-[[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[4-bromo-2-[[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 4247539 |
| Molecular Formula | C42H34Br2N6O8 |
| Molecular Weight | 910.58 g/mol |
| Exact Mass | 908.08 |
| IUPAC Name | bis[4-bromo-2-[[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] benzene-1,2-dicarboxylate |
| SMILES | CCC(=O)Nc1ccc(C(=O)NN=Cc2cc(Br)ccc2OC(=O)c2ccccc2C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2ccc(NC(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C42H34Br2N6O8/c1-3-37(51)47-31-15-9-25(10-16-31)39(53)49-45-23-27-21-29(43)13-19-35(27)57-41(55)33-7-5-6-8-34(33)42(56)58-36-20-14-30(44)22-28(36)24-46-50-40(54)26-11-17-32(18-12-26)48-38(52)4-2/h5-24H,3-4H2,1-2H3,(H,47,51)(H,48,52)(H,49,53)(H,50,54) |
| InChIKey | KFGCACINFZDVFC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 193.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.58 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|