C21H14Br2N2O3 — CID 5175869
[4-bromo-2-[[(3-bromobenzoyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 5175869) has the molecular formula C21H14Br2N2O3 and a molecular weight of 502.16 g/mol. Its IUPAC name is [4-bromo-2-[[(3-bromobenzoyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-bromo-2-[[(3-bromobenzoyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 5175869 |
| Molecular Formula | C21H14Br2N2O3 |
| Molecular Weight | 502.16 g/mol |
| Exact Mass | 499.94 |
| IUPAC Name | [4-bromo-2-[[(3-bromobenzoyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(NN=Cc1cc(Br)ccc1OC(=O)c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H14Br2N2O3/c22-17-8-4-7-15(11-17)20(26)25-24-13-16-12-18(23)9-10-19(16)28-21(27)14-5-2-1-3-6-14/h1-13H,(H,25,26) |
| InChIKey | MWHOHCDQXINQKG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.16 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|