C36H22Br2N6O10 — CID 6522591
bis[4-bromo-2-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] benzene-1,2-dicarboxylate (PubChem CID 6522591) has the molecular formula C36H22Br2N6O10 and a molecular weight of 858.41 g/mol. Its IUPAC name is bis[4-bromo-2-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[4-bromo-2-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6522591 |
| Molecular Formula | C36H22Br2N6O10 |
| Molecular Weight | 858.41 g/mol |
| Exact Mass | 855.98 |
| IUPAC Name | bis[4-bromo-2-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] benzene-1,2-dicarboxylate |
| SMILES | O=C(N/N=C\c1cc(Br)ccc1OC(=O)c1ccccc1C(=O)Oc1ccc(Br)cc1/C=N\NC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H22Br2N6O10/c37-25-9-15-31(23(17-25)19-39-41-33(45)21-5-11-27(12-6-21)43(49)50)53-35(47)29-3-1-2-4-30(29)36(48)54-32-16-10-26(38)18-24(32)20-40-42-34(46)22-7-13-28(14-8-22)44(51)52/h1-20H,(H,41,45)(H,42,46)/b39-19-,40-20- |
| InChIKey | RXDXLTZFJCWRKW-AJXXTLFWSA-N |
| XLogP | 6.99 |
| TPSA | 221.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.41 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|