C28H19BrN4O6S — CID 129439336
[2-[[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4-bromophenyl] 4-nitrobenzoate (PubChem CID 129439336) has the molecular formula C28H19BrN4O6S and a molecular weight of 619.45 g/mol. Its IUPAC name is [2-[[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4-bromophenyl] 4-nitrobenzoate.
| Compound Name | [2-[[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4-bromophenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 129439336 |
| Molecular Formula | C28H19BrN4O6S |
| Molecular Weight | 619.45 g/mol |
| Exact Mass | 618.02 |
| IUPAC Name | [2-[[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4-bromophenyl] 4-nitrobenzoate |
| SMILES | O=C(NN=Cc1cc(Br)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H19BrN4O6S/c29-21-10-13-25(39-28(36)19-8-11-22(12-9-19)33(37)38)20(15-21)17-30-32-27(35)24(16-23-7-4-14-40-23)31-26(34)18-5-2-1-3-6-18/h1-17H,(H,31,34)(H,32,35)/b24-16-,30-17? |
| InChIKey | LPCHNCWEFZCFKA-PPFCWGEYSA-N |
| XLogP | 5.56 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|