C27H29ClN2O3 — CID 6321755
4-[(4-chlorophenyl)methoxy]-N-[(E)-(2-hexoxyphenyl)methylideneamino]benzamide (PubChem CID 6321755) has the molecular formula C27H29ClN2O3 and a molecular weight of 464.99 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-N-[(E)-(2-hexoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-N-[(E)-(2-hexoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6321755 |
| Molecular Formula | C27H29ClN2O3 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-N-[(E)-(2-hexoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCCCCOc1ccccc1/C=N/NC(=O)c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H29ClN2O3/c1-2-3-4-7-18-32-26-9-6-5-8-23(26)19-29-30-27(31)22-12-16-25(17-13-22)33-20-21-10-14-24(28)15-11-21/h5-6,8-17,19H,2-4,7,18,20H2,1H3,(H,30,31)/b29-19+ |
| InChIKey | ZKGKHDOILGKHJO-VUTHCHCSSA-N |
| XLogP | 6.64 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|