C30H25ClN2O5 — CID 51060766
methyl 4-[[2-[(E)-[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 51060766) has the molecular formula C30H25ClN2O5 and a molecular weight of 528.99 g/mol. Its IUPAC name is methyl 4-[[2-[(E)-[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[2-[(E)-[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 51060766 |
| Molecular Formula | C30H25ClN2O5 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | methyl 4-[[2-[(E)-[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccccc2/C=N/NC(=O)c2ccc(OCc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H25ClN2O5/c1-36-30(35)24-10-6-21(7-11-24)20-38-28-5-3-2-4-25(28)18-32-33-29(34)23-12-16-27(17-13-23)37-19-22-8-14-26(31)15-9-22/h2-18H,19-20H2,1H3,(H,33,34)/b32-18+ |
| InChIKey | VTDMDWNCAUBYNN-KCSSXMTESA-N |
| XLogP | 6.05 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|