C34H34N2O5 — CID 6057527
methyl 4-[[2-[(Z)-[[4-[(4-tert-butylphenoxy)methyl]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 6057527) has the molecular formula C34H34N2O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is methyl 4-[[2-[(Z)-[[4-[(4-tert-butylphenoxy)methyl]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[2-[(Z)-[[4-[(4-tert-butylphenoxy)methyl]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 6057527 |
| Molecular Formula | C34H34N2O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | methyl 4-[[2-[(Z)-[[4-[(4-tert-butylphenoxy)methyl]benzoyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccccc2/C=N\NC(=O)c2ccc(COc3ccc(C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H34N2O5/c1-34(2,3)29-17-19-30(20-18-29)40-22-24-9-13-26(14-10-24)32(37)36-35-21-28-7-5-6-8-31(28)41-23-25-11-15-27(16-12-25)33(38)39-4/h5-21H,22-23H2,1-4H3,(H,36,37)/b35-21- |
| InChIKey | DIKVVMXIJQCIMQ-IPHFVPNQSA-N |
| XLogP | 6.69 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|