C33H29ClN2O2 — CID 2391842
4-[(4-tert-butylphenoxy)methyl]-N-[(10-chloroanthracen-9-yl)methylideneamino]benzamide (PubChem CID 2391842) has the molecular formula C33H29ClN2O2 and a molecular weight of 521.06 g/mol. Its IUPAC name is 4-[(4-tert-butylphenoxy)methyl]-N-[(10-chloroanthracen-9-yl)methylideneamino]benzamide.
| Compound Name | 4-[(4-tert-butylphenoxy)methyl]-N-[(10-chloroanthracen-9-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2391842 |
| Molecular Formula | C33H29ClN2O2 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 4-[(4-tert-butylphenoxy)methyl]-N-[(10-chloroanthracen-9-yl)methylideneamino]benzamide |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)NN=Cc3c4ccccc4c(Cl)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C33H29ClN2O2/c1-33(2,3)24-16-18-25(19-17-24)38-21-22-12-14-23(15-13-22)32(37)36-35-20-30-26-8-4-6-10-28(26)31(34)29-11-7-5-9-27(29)30/h4-20H,21H2,1-3H3,(H,36,37) |
| InChIKey | OCLFZLGUKCNIID-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|