C35H25ClN2O2 — CID 6903402
N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide (PubChem CID 6903402) has the molecular formula C35H25ClN2O2 and a molecular weight of 541.05 g/mol. Its IUPAC name is N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide.
| Compound Name | N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 6903402 |
| Molecular Formula | C35H25ClN2O2 |
| Molecular Weight | 541.05 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide |
| SMILES | O=C(N/N=C/c1c2ccccc2c(Cl)c2ccccc12)c1ccc(COc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H25ClN2O2/c36-34-30-15-6-4-13-28(30)32(29-14-5-7-16-31(29)34)22-37-38-35(39)26-20-18-24(19-21-26)23-40-33-17-9-8-12-27(33)25-10-2-1-3-11-25/h1-22H,23H2,(H,38,39)/b37-22+ |
| InChIKey | ZFGAIQSNEGQNRU-SEBMTOOBSA-N |
| XLogP | 8.66 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.05 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|