C29H26N2O5 — CID 3944391
N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide (PubChem CID 3944391) has the molecular formula C29H26N2O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide.
| Compound Name | N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 3944391 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(COc3ccccc3-c3ccccc3)cc2)cc(OC)c1O |
| InChI | InChI=1S/C29H26N2O5/c1-34-26-16-21(17-27(35-2)28(26)32)18-30-31-29(33)23-14-12-20(13-15-23)19-36-25-11-7-6-10-24(25)22-8-4-3-5-9-22/h3-18,32H,19H2,1-2H3,(H,31,33) |
| InChIKey | BUEGMHURVZZNLZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|