C29H26N2O4 — CID 6904277
N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide (PubChem CID 6904277) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide.
| Compound Name | N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 6904277 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-4-[(2-phenylphenoxy)methyl]benzamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2ccc(COc3ccccc3-c3ccccc3)cc2)c1OC |
| InChI | InChI=1S/C29H26N2O4/c1-33-27-14-8-11-24(28(27)34-2)19-30-31-29(32)23-17-15-21(16-18-23)20-35-26-13-7-6-12-25(26)22-9-4-3-5-10-22/h3-19H,20H2,1-2H3,(H,31,32)/b30-19+ |
| InChIKey | PFTOVGRTFZKBRR-NDZAJKAJSA-N |
| XLogP | 5.71 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|