C28H32N4O3 — CID 3750438
4-[(4-benzylpiperazin-1-yl)methyl]-N-[(2,3-dimethoxyphenyl)methylideneamino]benzamide (PubChem CID 3750438) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(2,3-dimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(2,3-dimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3750438 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(2,3-dimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cccc(C=NNC(=O)c2ccc(CN3CCN(Cc4ccccc4)CC3)cc2)c1OC |
| InChI | InChI=1S/C28H32N4O3/c1-34-26-10-6-9-25(27(26)35-2)19-29-30-28(33)24-13-11-23(12-14-24)21-32-17-15-31(16-18-32)20-22-7-4-3-5-8-22/h3-14,19H,15-18,20-21H2,1-2H3,(H,30,33) |
| InChIKey | LPRAOZPVVGQHHM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|