C27H29BrN4O3 — CID 124578511
N-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide (PubChem CID 124578511) has the molecular formula C27H29BrN4O3 and a molecular weight of 537.46 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 124578511 |
| Molecular Formula | C27H29BrN4O3 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(CN3CCN(c4ccccc4)CC3)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C27H29BrN4O3/c1-34-25-17-21(16-24(28)26(25)35-2)18-29-30-27(33)22-10-8-20(9-11-22)19-31-12-14-32(15-13-31)23-6-4-3-5-7-23/h3-11,16-18H,12-15,19H2,1-2H3,(H,30,33)/b29-18- |
| InChIKey | DAQWXAOHBCBZQH-MIXAMLLLSA-N |
| XLogP | 4.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|