C33H33N5O3 — CID 124578501
N-[(Z)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide (PubChem CID 124578501) has the molecular formula C33H33N5O3 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[(Z)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[(Z)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 124578501 |
| Molecular Formula | C33H33N5O3 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | N-[(Z)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)c2ccc(CN3CCN(c4ccccc4)CC3)cc2)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C33H33N5O3/c39-32(35-29-7-3-1-4-8-29)25-41-31-17-13-26(14-18-31)23-34-36-33(40)28-15-11-27(12-16-28)24-37-19-21-38(22-20-37)30-9-5-2-6-10-30/h1-18,23H,19-22,24-25H2,(H,35,39)(H,36,40)/b34-23- |
| InChIKey | JWSAHFAQKSOLBJ-XSVYLIDLSA-N |
| XLogP | 4.79 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|