C25H25BrN4O — CID 3788046
N-[(4-bromophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide (PubChem CID 3788046) has the molecular formula C25H25BrN4O and a molecular weight of 477.41 g/mol. Its IUPAC name is N-[(4-bromophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[(4-bromophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 3788046 |
| Molecular Formula | C25H25BrN4O |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-[(4-bromophenyl)methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
| SMILES | O=C(NN=Cc1ccc(Br)cc1)c1ccc(CN2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H25BrN4O/c26-23-12-8-20(9-13-23)18-27-28-25(31)22-10-6-21(7-11-22)19-29-14-16-30(17-15-29)24-4-2-1-3-5-24/h1-13,18H,14-17,19H2,(H,28,31) |
| InChIKey | ZMMUDNHWCOPRRA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|