C34H33BrFN5O2 — CID 66638646
5-bromo-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]benzoyl]amino]benzamide (PubChem CID 66638646) has the molecular formula C34H33BrFN5O2 and a molecular weight of 642.57 g/mol. Its IUPAC name is 5-bromo-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]benzoyl]amino]benzamide.
| Compound Name | 5-bromo-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 66638646 |
| Molecular Formula | C34H33BrFN5O2 |
| Molecular Weight | 642.57 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | 5-bromo-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]benzoyl]amino]benzamide |
| SMILES | Cc1ccc(C=NNC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CN3CCN(c4ccc(F)cc4)CC3)cc2)cc1C |
| InChI | InChI=1S/C34H33BrFN5O2/c1-23-3-4-26(19-24(23)2)21-37-39-34(43)31-20-28(35)9-14-32(31)38-33(42)27-7-5-25(6-8-27)22-40-15-17-41(18-16-40)30-12-10-29(36)11-13-30/h3-14,19-21H,15-18,22H2,1-2H3,(H,38,42)(H,39,43) |
| InChIKey | FDIJTMHIJYOZKA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|