C31H38BrN5O4 — CID 23107878
2-[[4-[[3-[bis(2-hydroxyethyl)amino]propylamino]methyl]benzoyl]amino]-5-bromo-N-[(E)-(3,4-dimethylphenyl)methylideneamino]benzamide (PubChem CID 23107878) has the molecular formula C31H38BrN5O4 and a molecular weight of 624.58 g/mol. Its IUPAC name is 2-[[4-[[3-[bis(2-hydroxyethyl)amino]propylamino]methyl]benzoyl]amino]-5-bromo-N-[(E)-(3,4-dimethylphenyl)methylideneamino]benzamide.
| Compound Name | 2-[[4-[[3-[bis(2-hydroxyethyl)amino]propylamino]methyl]benzoyl]amino]-5-bromo-N-[(E)-(3,4-dimethylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107878 |
| Molecular Formula | C31H38BrN5O4 |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 2-[[4-[[3-[bis(2-hydroxyethyl)amino]propylamino]methyl]benzoyl]amino]-5-bromo-N-[(E)-(3,4-dimethylphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CNCCCN(CCO)CCO)cc2)cc1C |
| InChI | InChI=1S/C31H38BrN5O4/c1-22-4-5-25(18-23(22)2)21-34-36-31(41)28-19-27(32)10-11-29(28)35-30(40)26-8-6-24(7-9-26)20-33-12-3-13-37(14-16-38)15-17-39/h4-11,18-19,21,33,38-39H,3,12-17,20H2,1-2H3,(H,35,40)(H,36,41)/b34-21+ |
| InChIKey | BKUUICFUURQWEV-KEIPNQJHSA-N |
| XLogP | 3.85 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|