C29H34BrN5O2 — CID 23107642
5-bromo-2-[[4-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-N-[(E)-(3-methylphenyl)methylideneamino]benzamide (PubChem CID 23107642) has the molecular formula C29H34BrN5O2 and a molecular weight of 564.53 g/mol. Its IUPAC name is 5-bromo-2-[[4-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-N-[(E)-(3-methylphenyl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-[[4-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-N-[(E)-(3-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107642 |
| Molecular Formula | C29H34BrN5O2 |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 5-bromo-2-[[4-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-N-[(E)-(3-methylphenyl)methylideneamino]benzamide |
| SMILES | CCN(CC)CCNCc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)N/N=C/c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C29H34BrN5O2/c1-4-35(5-2)16-15-31-19-22-9-11-24(12-10-22)28(36)33-27-14-13-25(30)18-26(27)29(37)34-32-20-23-8-6-7-21(3)17-23/h6-14,17-18,20,31H,4-5,15-16,19H2,1-3H3,(H,33,36)(H,34,37)/b32-20+ |
| InChIKey | PLVDEDFENZZUDJ-UZWMFBFFSA-N |
| XLogP | 5.21 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|