C30H36ClN5O2 — CID 66637341
5-chloro-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(3-methylphenyl)methylideneamino]benzamide (PubChem CID 66637341) has the molecular formula C30H36ClN5O2 and a molecular weight of 534.10 g/mol. Its IUPAC name is 5-chloro-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(3-methylphenyl)methylideneamino]benzamide.
| Compound Name | 5-chloro-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(3-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 66637341 |
| Molecular Formula | C30H36ClN5O2 |
| Molecular Weight | 534.10 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 5-chloro-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(3-methylphenyl)methylideneamino]benzamide |
| SMILES | CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2ccc(Cl)cc2C(=O)NN=Cc2cccc(C)c2)c1 |
| InChI | InChI=1S/C30H36ClN5O2/c1-5-36(6-2)16-15-35(4)21-24-11-8-12-25(18-24)29(37)33-28-14-13-26(31)19-27(28)30(38)34-32-20-23-10-7-9-22(3)17-23/h7-14,17-20H,5-6,15-16,21H2,1-4H3,(H,33,37)(H,34,38) |
| InChIKey | MQHOUXSGJOKCPX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.10 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|