C30H32Cl2F3N5O2 — CID 66638793
5-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]benzamide (PubChem CID 66638793) has the molecular formula C30H32Cl2F3N5O2 and a molecular weight of 622.52 g/mol. Its IUPAC name is 5-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 66638793 |
| Molecular Formula | C30H32Cl2F3N5O2 |
| Molecular Weight | 622.52 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | 5-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]benzamide |
| SMILES | CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2ccc(Cl)cc2C(=O)NN=Cc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C30H32Cl2F3N5O2/c1-4-40(5-2)14-13-39(3)19-21-7-6-8-22(15-21)28(41)37-27-12-10-23(31)17-24(27)29(42)38-36-18-20-9-11-26(32)25(16-20)30(33,34)35/h6-12,15-18H,4-5,13-14,19H2,1-3H3,(H,37,41)(H,38,42) |
| InChIKey | RELMMJIEMIMAJM-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.52 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|