C25H17Cl2F3N6O2S — CID 66638189
5-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoyl]amino]benzamide (PubChem CID 66638189) has the molecular formula C25H17Cl2F3N6O2S and a molecular weight of 593.42 g/mol. Its IUPAC name is 5-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 66638189 |
| Molecular Formula | C25H17Cl2F3N6O2S |
| Molecular Weight | 593.42 g/mol |
| Exact Mass | 592.05 |
| IUPAC Name | 5-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)NN=Cc1ccc(Cl)c(C(F)(F)F)c1)c1cccc(CSc2ncn[nH]2)c1 |
| InChI | InChI=1S/C25H17Cl2F3N6O2S/c26-17-5-7-21(34-22(37)16-3-1-2-15(8-16)12-39-24-31-13-33-36-24)18(10-17)23(38)35-32-11-14-4-6-20(27)19(9-14)25(28,29)30/h1-11,13H,12H2,(H,34,37)(H,35,38)(H,31,33,36) |
| InChIKey | JUUXFJKAUIEQPK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.42 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|