C25H17BrClF3N6O2S — CID 87086093
5-bromo-N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[sulfanyl(1H-1,2,4-triazol-5-yl)methyl]benzoyl]amino]benzamide (PubChem CID 87086093) has the molecular formula C25H17BrClF3N6O2S and a molecular weight of 637.87 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[sulfanyl(1H-1,2,4-triazol-5-yl)methyl]benzoyl]amino]benzamide.
| Compound Name | 5-bromo-N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[sulfanyl(1H-1,2,4-triazol-5-yl)methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 87086093 |
| Molecular Formula | C25H17BrClF3N6O2S |
| Molecular Weight | 637.87 g/mol |
| Exact Mass | 636.00 |
| IUPAC Name | 5-bromo-N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[sulfanyl(1H-1,2,4-triazol-5-yl)methyl]benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1C(=O)N/N=C\c1ccc(Cl)c(C(F)(F)F)c1)c1cccc(C(S)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C25H17BrClF3N6O2S/c26-16-5-7-20(34-23(37)15-3-1-2-14(9-15)21(39)22-31-12-33-35-22)17(10-16)24(38)36-32-11-13-4-6-19(27)18(8-13)25(28,29)30/h1-12,21,39H,(H,34,37)(H,36,38)(H,31,33,35)/b32-11- |
| InChIKey | CYIGTFKMEWPLOU-MDVINBTASA-N |
| XLogP | 6.27 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.87 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|