C24H22N6O3S2 — CID 87086161
N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methyl-2-[[3-[sulfanyl(1H-1,2,4-triazol-5-yl)methyl]benzoyl]amino]thiophene-3-carboxamide (PubChem CID 87086161) has the molecular formula C24H22N6O3S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methyl-2-[[3-[sulfanyl(1H-1,2,4-triazol-5-yl)methyl]benzoyl]amino]thiophene-3-carboxamide.
| Compound Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methyl-2-[[3-[sulfanyl(1H-1,2,4-triazol-5-yl)methyl]benzoyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 87086161 |
| Molecular Formula | C24H22N6O3S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methyl-2-[[3-[sulfanyl(1H-1,2,4-triazol-5-yl)methyl]benzoyl]amino]thiophene-3-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2c(C)csc2NC(=O)c2cccc(C(S)c3ncn[nH]3)c2)cc1 |
| InChI | InChI=1S/C24H22N6O3S2/c1-14-12-35-24(19(14)23(32)30-26-11-15-6-8-18(33-2)9-7-15)28-22(31)17-5-3-4-16(10-17)20(34)21-25-13-27-29-21/h3-13,20,34H,1-2H3,(H,28,31)(H,30,32)(H,25,27,29)/b26-11+ |
| InChIKey | DDFNWEUAFUOFFE-KBKYJPHKSA-N |
| XLogP | 4.22 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|