C28H34N4O5S — CID 66639503
2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(4-methoxyphenyl)methylideneamino]-4-methylthiophene-3-carboxamide (PubChem CID 66639503) has the molecular formula C28H34N4O5S and a molecular weight of 538.67 g/mol. Its IUPAC name is 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(4-methoxyphenyl)methylideneamino]-4-methylthiophene-3-carboxamide.
| Compound Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(4-methoxyphenyl)methylideneamino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 66639503 |
| Molecular Formula | C28H34N4O5S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(4-methoxyphenyl)methylideneamino]-4-methylthiophene-3-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2c(C)csc2NC(=O)c2cccc(CN(CC(C)O)CC(C)O)c2)cc1 |
| InChI | InChI=1S/C28H34N4O5S/c1-18-17-38-28(25(18)27(36)31-29-13-21-8-10-24(37-4)11-9-21)30-26(35)23-7-5-6-22(12-23)16-32(14-19(2)33)15-20(3)34/h5-13,17,19-20,33-34H,14-16H2,1-4H3,(H,30,35)(H,31,36) |
| InChIKey | WAUUYWDMPPOBAH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|