C33H36N4O4 — CID 66638947
3-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(4-methylphenyl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 66638947) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(4-methylphenyl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | 3-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(4-methylphenyl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 66638947 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 3-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(4-methylphenyl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | Cc1ccc(C=NNC(=O)c2cc3ccccc3cc2NC(=O)c2cccc(CN(CC(C)O)CC(C)O)c2)cc1 |
| InChI | InChI=1S/C33H36N4O4/c1-22-11-13-25(14-12-22)18-34-36-33(41)30-16-27-8-4-5-9-28(27)17-31(30)35-32(40)29-10-6-7-26(15-29)21-37(19-23(2)38)20-24(3)39/h4-18,23-24,38-39H,19-21H2,1-3H3,(H,35,40)(H,36,41) |
| InChIKey | VBFJYJVSIYPKCB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|