C38H51N5O6 — CID 23107753
2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-(2-hydroxy-3-piperidin-1-ylpropoxy)benzamide (PubChem CID 23107753) has the molecular formula C38H51N5O6 and a molecular weight of 673.86 g/mol. Its IUPAC name is 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-(2-hydroxy-3-piperidin-1-ylpropoxy)benzamide.
| Compound Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-(2-hydroxy-3-piperidin-1-ylpropoxy)benzamide |
|---|---|
| PubChem CID | 23107753 |
| Molecular Formula | C38H51N5O6 |
| Molecular Weight | 673.86 g/mol |
| Exact Mass | 673.38 |
| IUPAC Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-(2-hydroxy-3-piperidin-1-ylpropoxy)benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(OCC(O)CN3CCCCC3)ccc2NC(=O)c2cccc(CN(CC(C)O)CC(C)O)c2)cc1C |
| InChI | InChI=1S/C38H51N5O6/c1-26-11-12-30(17-27(26)2)20-39-41-38(48)35-19-34(49-25-33(46)24-42-15-6-5-7-16-42)13-14-36(35)40-37(47)32-10-8-9-31(18-32)23-43(21-28(3)44)22-29(4)45/h8-14,17-20,28-29,33,44-46H,5-7,15-16,21-25H2,1-4H3,(H,40,47)(H,41,48)/b39-20+ |
| InChIKey | KKTBKGYEYMXELO-JOXMEQDKSA-N |
| XLogP | 4.11 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|