C30H35FN4O4S — CID 23108009
2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(4-fluorophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 23108009) has the molecular formula C30H35FN4O4S and a molecular weight of 566.70 g/mol. Its IUPAC name is 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(4-fluorophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(4-fluorophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 23108009 |
| Molecular Formula | C30H35FN4O4S |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(4-fluorophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(O)CN(Cc1cccc(C(=O)Nc2sc3c(c2C(=O)N/N=C/c2ccc(F)cc2)CCCC3)c1)CC(C)O |
| InChI | InChI=1S/C30H35FN4O4S/c1-19(36)16-35(17-20(2)37)18-22-6-5-7-23(14-22)28(38)33-30-27(25-8-3-4-9-26(25)40-30)29(39)34-32-15-21-10-12-24(31)13-11-21/h5-7,10-15,19-20,36-37H,3-4,8-9,16-18H2,1-2H3,(H,33,38)(H,34,39)/b32-15+ |
| InChIKey | YFORDCADDUIFAY-VWJSQJICSA-N |
| XLogP | 4.35 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|