C31H36N4O3S — CID 23107332
N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[3-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 23107332) has the molecular formula C31H36N4O3S and a molecular weight of 544.72 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[3-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[3-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 23107332 |
| Molecular Formula | C31H36N4O3S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[3-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2c(NC(=O)c3cccc(CN4CCC(O)CC4)c3)sc3c2CCCC3)cc1C |
| InChI | InChI=1S/C31H36N4O3S/c1-20-10-11-22(16-21(20)2)18-32-34-30(38)28-26-8-3-4-9-27(26)39-31(28)33-29(37)24-7-5-6-23(17-24)19-35-14-12-25(36)13-15-35/h5-7,10-11,16-18,25,36H,3-4,8-9,12-15,19H2,1-2H3,(H,33,37)(H,34,38)/b32-18+ |
| InChIKey | KSVAOUJRKLVHBQ-KCSSXMTESA-N |
| XLogP | 5.22 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|