C27H26ClF3N4O3S — CID 23108237
N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-4-methylthiophene-3-carboxamide (PubChem CID 23108237) has the molecular formula C27H26ClF3N4O3S and a molecular weight of 579.04 g/mol. Its IUPAC name is N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-4-methylthiophene-3-carboxamide.
| Compound Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 23108237 |
| Molecular Formula | C27H26ClF3N4O3S |
| Molecular Weight | 579.04 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-4-methylthiophene-3-carboxamide |
| SMILES | Cc1csc(NC(=O)c2cccc(CN3CCC(O)CC3)c2)c1C(=O)N/N=C/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H26ClF3N4O3S/c1-16-15-39-26(23(16)25(38)34-32-13-17-5-6-22(28)21(12-17)27(29,30)31)33-24(37)19-4-2-3-18(11-19)14-35-9-7-20(36)8-10-35/h2-6,11-13,15,20,36H,7-10,14H2,1H3,(H,33,37)(H,34,38)/b32-13+ |
| InChIKey | RCUYYAWUZFNLIY-JJKQSNDFSA-N |
| XLogP | 5.70 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.04 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|