C28H29FN4O4S — CID 58712787
2-[[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)benzoyl]amino]-N-[(E)-(4-fluorophenyl)methylideneamino]-4-methylthiophene-3-carboxamide (PubChem CID 58712787) has the molecular formula C28H29FN4O4S and a molecular weight of 536.63 g/mol. Its IUPAC name is 2-[[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)benzoyl]amino]-N-[(E)-(4-fluorophenyl)methylideneamino]-4-methylthiophene-3-carboxamide.
| Compound Name | 2-[[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)benzoyl]amino]-N-[(E)-(4-fluorophenyl)methylideneamino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 58712787 |
| Molecular Formula | C28H29FN4O4S |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-[[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)benzoyl]amino]-N-[(E)-(4-fluorophenyl)methylideneamino]-4-methylthiophene-3-carboxamide |
| SMILES | Cc1csc(NC(=O)c2cccc(CN3CCC4(CC3)OCCO4)c2)c1C(=O)N/N=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C28H29FN4O4S/c1-19-18-38-27(24(19)26(35)32-30-16-20-5-7-23(29)8-6-20)31-25(34)22-4-2-3-21(15-22)17-33-11-9-28(10-12-33)36-13-14-37-28/h2-8,15-16,18H,9-14,17H2,1H3,(H,31,34)(H,32,35)/b30-16+ |
| InChIKey | VYPVIZOYDYWKOM-OKCVXOCRSA-N |
| XLogP | 4.55 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|