C29H35N5O3S — CID 66638649
N-[(3,4-dimethylphenyl)methylideneamino]-3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-4-methylthiophene-2-carboxamide (PubChem CID 66638649) has the molecular formula C29H35N5O3S and a molecular weight of 533.70 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methylideneamino]-3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-4-methylthiophene-2-carboxamide.
| Compound Name | N-[(3,4-dimethylphenyl)methylideneamino]-3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 66638649 |
| Molecular Formula | C29H35N5O3S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methylideneamino]-3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C=NNC(=O)c2scc(C)c2NC(=O)c2cccc(CN3CCN(CCO)CC3)c2)cc1C |
| InChI | InChI=1S/C29H35N5O3S/c1-20-7-8-23(15-21(20)2)17-30-32-29(37)27-26(22(3)19-38-27)31-28(36)25-6-4-5-24(16-25)18-34-11-9-33(10-12-34)13-14-35/h4-8,15-17,19,35H,9-14,18H2,1-3H3,(H,31,36)(H,32,37) |
| InChIKey | SJNPWNVJCOBWST-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|