C33H35N5O4 — CID 66638537
3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-N-[(4-methoxyphenyl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 66638537) has the molecular formula C33H35N5O4 and a molecular weight of 565.67 g/mol. Its IUPAC name is 3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-N-[(4-methoxyphenyl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | 3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-N-[(4-methoxyphenyl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 66638537 |
| Molecular Formula | C33H35N5O4 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-N-[(4-methoxyphenyl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2cc3ccccc3cc2NC(=O)c2cccc(CN3CCN(CCO)CC3)c2)cc1 |
| InChI | InChI=1S/C33H35N5O4/c1-42-29-11-9-24(10-12-29)22-34-36-33(41)30-20-26-6-2-3-7-27(26)21-31(30)35-32(40)28-8-4-5-25(19-28)23-38-15-13-37(14-16-38)17-18-39/h2-12,19-22,39H,13-18,23H2,1H3,(H,35,40)(H,36,41) |
| InChIKey | HYHSRZOGHIVUSG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|