C29H31BrN4O4 — CID 23107764
5-bromo-2-[[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 23107764) has the molecular formula C29H31BrN4O4 and a molecular weight of 579.50 g/mol. Its IUPAC name is 5-bromo-2-[[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-[[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107764 |
| Molecular Formula | C29H31BrN4O4 |
| Molecular Weight | 579.50 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | 5-bromo-2-[[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CN3CCC(CO)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H31BrN4O4/c1-38-25-9-4-20(5-10-25)17-31-33-29(37)26-16-24(30)8-11-27(26)32-28(36)23-6-2-21(3-7-23)18-34-14-12-22(19-35)13-15-34/h2-11,16-17,22,35H,12-15,18-19H2,1H3,(H,32,36)(H,33,37)/b31-17+ |
| InChIKey | XMZQDMQAZYZIPX-KBVAKVRCSA-N |
| XLogP | 4.68 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|