C28H29BrFN5O3 — CID 23107708
5-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-2-[[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]benzamide (PubChem CID 23107708) has the molecular formula C28H29BrFN5O3 and a molecular weight of 582.47 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-2-[[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]benzamide.
| Compound Name | 5-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-2-[[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 23107708 |
| Molecular Formula | C28H29BrFN5O3 |
| Molecular Weight | 582.47 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | 5-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-2-[[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1C(=O)N/N=C/c1ccc(F)cc1)c1ccc(CN2CCN(CCO)CC2)cc1 |
| InChI | InChI=1S/C28H29BrFN5O3/c29-23-7-10-26(25(17-23)28(38)33-31-18-20-3-8-24(30)9-4-20)32-27(37)22-5-1-21(2-6-22)19-35-13-11-34(12-14-35)15-16-36/h1-10,17-18,36H,11-16,19H2,(H,32,37)(H,33,38)/b31-18+ |
| InChIKey | IFXNIHHYOZSHBR-FDAWAROLSA-N |
| XLogP | 3.71 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|