C27H20BrFN4O2S — CID 87086304
5-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-2-[[4-[pyridin-4-yl(sulfanyl)methyl]benzoyl]amino]benzamide (PubChem CID 87086304) has the molecular formula C27H20BrFN4O2S and a molecular weight of 563.45 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-2-[[4-[pyridin-4-yl(sulfanyl)methyl]benzoyl]amino]benzamide.
| Compound Name | 5-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-2-[[4-[pyridin-4-yl(sulfanyl)methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 87086304 |
| Molecular Formula | C27H20BrFN4O2S |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | 5-bromo-N-[(E)-(4-fluorophenyl)methylideneamino]-2-[[4-[pyridin-4-yl(sulfanyl)methyl]benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1C(=O)N/N=C/c1ccc(F)cc1)c1ccc(C(S)c2ccncc2)cc1 |
| InChI | InChI=1S/C27H20BrFN4O2S/c28-21-7-10-24(23(15-21)27(35)33-31-16-17-1-8-22(29)9-2-17)32-26(34)20-5-3-18(4-6-20)25(36)19-11-13-30-14-12-19/h1-16,25,36H,(H,32,34)(H,33,35)/b31-16+ |
| InChIKey | HJGFGPRAWKVKLT-WCMJOSRZSA-N |
| XLogP | 6.02 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|