C21H17BrN4O2 — CID 66638175
N-[4-bromo-2-[[(3-methylphenyl)methylideneamino]carbamoyl]phenyl]pyridine-4-carboxamide (PubChem CID 66638175) has the molecular formula C21H17BrN4O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is N-[4-bromo-2-[[(3-methylphenyl)methylideneamino]carbamoyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[4-bromo-2-[[(3-methylphenyl)methylideneamino]carbamoyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66638175 |
| Molecular Formula | C21H17BrN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-[4-bromo-2-[[(3-methylphenyl)methylideneamino]carbamoyl]phenyl]pyridine-4-carboxamide |
| SMILES | Cc1cccc(C=NNC(=O)c2cc(Br)ccc2NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C21H17BrN4O2/c1-14-3-2-4-15(11-14)13-24-26-21(28)18-12-17(22)5-6-19(18)25-20(27)16-7-9-23-10-8-16/h2-13H,1H3,(H,25,27)(H,26,28) |
| InChIKey | WBJZODVFICCEHV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|