C29H32BrN5O4 — CID 23107775
5-bromo-2-[[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 23107775) has the molecular formula C29H32BrN5O4 and a molecular weight of 594.51 g/mol. Its IUPAC name is 5-bromo-2-[[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-[[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107775 |
| Molecular Formula | C29H32BrN5O4 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | 5-bromo-2-[[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CN3CCN(CCO)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H32BrN5O4/c1-39-25-9-4-21(5-10-25)19-31-33-29(38)26-18-24(30)8-11-27(26)32-28(37)23-6-2-22(3-7-23)20-35-14-12-34(13-15-35)16-17-36/h2-11,18-19,36H,12-17,20H2,1H3,(H,32,37)(H,33,38)/b31-19+ |
| InChIKey | LGLSOGACYYDKPM-ZCTHSVRISA-N |
| XLogP | 3.58 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|