C28H29BrN4O3 — CID 66639215
5-bromo-2-[[4-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-N-[(4-methylphenyl)methylideneamino]benzamide (PubChem CID 66639215) has the molecular formula C28H29BrN4O3 and a molecular weight of 549.47 g/mol. Its IUPAC name is 5-bromo-2-[[4-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-N-[(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-[[4-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-N-[(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 66639215 |
| Molecular Formula | C28H29BrN4O3 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 5-bromo-2-[[4-[(4-hydroxypiperidin-1-yl)methyl]benzoyl]amino]-N-[(4-methylphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(C=NNC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CN3CCC(O)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H29BrN4O3/c1-19-2-4-20(5-3-19)17-30-32-28(36)25-16-23(29)10-11-26(25)31-27(35)22-8-6-21(7-9-22)18-33-14-12-24(34)13-15-33/h2-11,16-17,24,34H,12-15,18H2,1H3,(H,31,35)(H,32,36) |
| InChIKey | GYVQSHFLIYRGFL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|