C25H24BrN3O5S — CID 23107696
5-bromo-2-[[3-(2-hydroxyethylsulfonylmethyl)benzoyl]amino]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide (PubChem CID 23107696) has the molecular formula C25H24BrN3O5S and a molecular weight of 558.45 g/mol. Its IUPAC name is 5-bromo-2-[[3-(2-hydroxyethylsulfonylmethyl)benzoyl]amino]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-[[3-(2-hydroxyethylsulfonylmethyl)benzoyl]amino]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107696 |
| Molecular Formula | C25H24BrN3O5S |
| Molecular Weight | 558.45 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | 5-bromo-2-[[3-(2-hydroxyethylsulfonylmethyl)benzoyl]amino]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(Br)ccc2NC(=O)c2cccc(CS(=O)(=O)CCO)c2)cc1 |
| InChI | InChI=1S/C25H24BrN3O5S/c1-17-5-7-18(8-6-17)15-27-29-25(32)22-14-21(26)9-10-23(22)28-24(31)20-4-2-3-19(13-20)16-35(33,34)12-11-30/h2-10,13-15,30H,11-12,16H2,1H3,(H,28,31)(H,29,32)/b27-15+ |
| InChIKey | PKSDNGKYROTJLC-JFLMPSFJSA-N |
| XLogP | 3.68 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|