C31H37BrN4O4 — CID 66638601
2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(4-methylphenyl)methylideneamino]benzamide (PubChem CID 66638601) has the molecular formula C31H37BrN4O4 and a molecular weight of 609.57 g/mol. Its IUPAC name is 2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | 2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 66638601 |
| Molecular Formula | C31H37BrN4O4 |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(4-methylphenyl)methylideneamino]benzamide |
| SMILES | CCOCCN(CCOCC)Cc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)NN=Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H37BrN4O4/c1-4-39-18-16-36(17-19-40-5-2)22-25-10-12-26(13-11-25)30(37)34-29-15-14-27(32)20-28(29)31(38)35-33-21-24-8-6-23(3)7-9-24/h6-15,20-21H,4-5,16-19,22H2,1-3H3,(H,34,37)(H,35,38) |
| InChIKey | MDAALORPPQHZSC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|