C27H29ClN4O4 — CID 66639120
2-[[3-[[bis(2-hydroxyethyl)amino]methyl]benzoyl]amino]-5-chloro-N-[(4-methylphenyl)methylideneamino]benzamide (PubChem CID 66639120) has the molecular formula C27H29ClN4O4 and a molecular weight of 509.01 g/mol. Its IUPAC name is 2-[[3-[[bis(2-hydroxyethyl)amino]methyl]benzoyl]amino]-5-chloro-N-[(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | 2-[[3-[[bis(2-hydroxyethyl)amino]methyl]benzoyl]amino]-5-chloro-N-[(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 66639120 |
| Molecular Formula | C27H29ClN4O4 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2-[[3-[[bis(2-hydroxyethyl)amino]methyl]benzoyl]amino]-5-chloro-N-[(4-methylphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(C=NNC(=O)c2cc(Cl)ccc2NC(=O)c2cccc(CN(CCO)CCO)c2)cc1 |
| InChI | InChI=1S/C27H29ClN4O4/c1-19-5-7-20(8-6-19)17-29-31-27(36)24-16-23(28)9-10-25(24)30-26(35)22-4-2-3-21(15-22)18-32(11-13-33)12-14-34/h2-10,15-17,33-34H,11-14,18H2,1H3,(H,30,35)(H,31,36) |
| InChIKey | FNJYYQXYXKYXDH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|