C26H26ClN3O3S — CID 77403292
5-chloro-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]benzamide (PubChem CID 77403292) has the molecular formula C26H26ClN3O3S and a molecular weight of 496.03 g/mol. Its IUPAC name is 5-chloro-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 77403292 |
| Molecular Formula | C26H26ClN3O3S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 5-chloro-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]benzamide |
| SMILES | Cc1ccc(C=NNC(=O)c2cc(Cl)ccc2NC(=O)c2cccc(CSCCO)c2)cc1C |
| InChI | InChI=1S/C26H26ClN3O3S/c1-17-6-7-19(12-18(17)2)15-28-30-26(33)23-14-22(27)8-9-24(23)29-25(32)21-5-3-4-20(13-21)16-34-11-10-31/h3-9,12-15,31H,10-11,16H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | DYXHWCPPJKFXEC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|