C32H38N4O3S — CID 23108086
N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-(4-methylpiperidin-1-yl)benzamide (PubChem CID 23108086) has the molecular formula C32H38N4O3S and a molecular weight of 558.75 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 23108086 |
| Molecular Formula | C32H38N4O3S |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-(4-methylpiperidin-1-yl)benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(N3CCC(C)CC3)ccc2NC(=O)c2cccc(CSCCO)c2)cc1C |
| InChI | InChI=1S/C32H38N4O3S/c1-22-11-13-36(14-12-22)28-9-10-30(34-31(38)27-6-4-5-26(18-27)21-40-16-15-37)29(19-28)32(39)35-33-20-25-8-7-23(2)24(3)17-25/h4-10,17-20,22,37H,11-16,21H2,1-3H3,(H,34,38)(H,35,39)/b33-20+ |
| InChIKey | YTKQQFGBMMLHQI-FMFFXOCNSA-N |
| XLogP | 5.78 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|