C34H41N5O5 — CID 23107903
2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 23107903) has the molecular formula C34H41N5O5 and a molecular weight of 599.73 g/mol. Its IUPAC name is 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 23107903 |
| Molecular Formula | C34H41N5O5 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(N3CCCC3=O)ccc2NC(=O)c2cccc(CN(CC(C)O)CC(C)O)c2)cc1C |
| InChI | InChI=1S/C34H41N5O5/c1-22-10-11-26(15-23(22)2)18-35-37-34(44)30-17-29(39-14-6-9-32(39)42)12-13-31(30)36-33(43)28-8-5-7-27(16-28)21-38(19-24(3)40)20-25(4)41/h5,7-8,10-13,15-18,24-25,40-41H,6,9,14,19-21H2,1-4H3,(H,36,43)(H,37,44)/b35-18+ |
| InChIKey | JOGOXKAYQSOFGM-MWBNBJEGSA-N |
| XLogP | 4.01 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|